C19H22BrClN2O5S — CID 28556276
N-[(1R)-1-(4-bromophenyl)ethyl]-2-[2-chloro-4-(2-methoxyethylsulfamoyl)phenoxy]acetamide (PubChem CID 28556276) has the molecular formula C19H22BrClN2O5S and a molecular weight of 505.82 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-2-[2-chloro-4-(2-methoxyethylsulfamoyl)phenoxy]acetamide.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-[2-chloro-4-(2-methoxyethylsulfamoyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 28556276 |
| Molecular Formula | C19H22BrClN2O5S |
| Molecular Weight | 505.82 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-[2-chloro-4-(2-methoxyethylsulfamoyl)phenoxy]acetamide |
| SMILES | COCCNS(=O)(=O)c1ccc(OCC(=O)N[C@H](C)c2ccc(Br)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H22BrClN2O5S/c1-13(14-3-5-15(20)6-4-14)23-19(24)12-28-18-8-7-16(11-17(18)21)29(25,26)22-9-10-27-2/h3-8,11,13,22H,9-10,12H2,1-2H3,(H,23,24)/t13-/m1/s1 |
| InChIKey | SOPNIBUEBHQBFF-CYBMUJFWSA-N |
| XLogP | 3.28 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|