C17H16FN3O3 — CID 100802202
[(E)-[2-(4-acetamidophenyl)-1-aminoethylidene]amino] 4-fluorobenzoate (PubChem CID 100802202) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is [(E)-[2-(4-acetamidophenyl)-1-aminoethylidene]amino] 4-fluorobenzoate.
| Compound Name | [(E)-[2-(4-acetamidophenyl)-1-aminoethylidene]amino] 4-fluorobenzoate |
|---|---|
| PubChem CID | 100802202 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [(E)-[2-(4-acetamidophenyl)-1-aminoethylidene]amino] 4-fluorobenzoate |
| SMILES | CC(=O)Nc1ccc(C/C(N)=N\OC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H16FN3O3/c1-11(22)20-15-8-2-12(3-9-15)10-16(19)21-24-17(23)13-4-6-14(18)7-5-13/h2-9H,10H2,1H3,(H2,19,21)(H,20,22) |
| InChIKey | ZUJJDGUNRLURMH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|