C12H15N3O3 — CID 98042086
[(Z)-(1,3-diamino-3-oxopropylidene)amino] 4-ethylbenzoate (PubChem CID 98042086) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is [(Z)-(1,3-diamino-3-oxopropylidene)amino] 4-ethylbenzoate.
| Compound Name | [(Z)-(1,3-diamino-3-oxopropylidene)amino] 4-ethylbenzoate |
|---|---|
| PubChem CID | 98042086 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | [(Z)-(1,3-diamino-3-oxopropylidene)amino] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)O/N=C(\N)CC(N)=O)cc1 |
| InChI | InChI=1S/C12H15N3O3/c1-2-8-3-5-9(6-4-8)12(17)18-15-10(13)7-11(14)16/h3-6H,2,7H2,1H3,(H2,13,15)(H2,14,16) |
| InChIKey | WTJDWSVZKLRJRJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|