C8H17NO — CID 10080514
(1S,2R)-1-methyl-1-oxido-2-propylpyrrolidin-1-ium (PubChem CID 10080514) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (1S,2R)-1-methyl-1-oxido-2-propylpyrrolidin-1-ium.
| Compound Name | (1S,2R)-1-methyl-1-oxido-2-propylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 10080514 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (1S,2R)-1-methyl-1-oxido-2-propylpyrrolidin-1-ium |
| SMILES | CCC[C@@H]1CCC[N@+]1(C)[O-] |
| InChI | InChI=1S/C8H17NO/c1-3-5-8-6-4-7-9(8,2)10/h8H,3-7H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | HATJXNCNRVGUHI-BDAKNGLRSA-N |
| XLogP | 1.89 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|