C20H24BrN3O — CID 100805457
N-[2-amino-4-methyl-5-[(2S)-2-methylpiperidin-1-yl]phenyl]-3-bromobenzamide (PubChem CID 100805457) has the molecular formula C20H24BrN3O and a molecular weight of 402.34 g/mol. Its IUPAC name is N-[2-amino-4-methyl-5-[(2S)-2-methylpiperidin-1-yl]phenyl]-3-bromobenzamide.
| Compound Name | N-[2-amino-4-methyl-5-[(2S)-2-methylpiperidin-1-yl]phenyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 100805457 |
| Molecular Formula | C20H24BrN3O |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-[2-amino-4-methyl-5-[(2S)-2-methylpiperidin-1-yl]phenyl]-3-bromobenzamide |
| SMILES | Cc1cc(N)c(NC(=O)c2cccc(Br)c2)cc1N1CCCC[C@@H]1C |
| InChI | InChI=1S/C20H24BrN3O/c1-13-10-17(22)18(12-19(13)24-9-4-3-6-14(24)2)23-20(25)15-7-5-8-16(21)11-15/h5,7-8,10-12,14H,3-4,6,9,22H2,1-2H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | RHFXOHCDWWUUMN-AWEZNQCLSA-N |
| XLogP | 4.97 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|