C20H24N2O4S — CID 100807206
(1R,2R,3S,4R)-3-[[3-(piperidine-1-carbonyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 100807206) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is (1R,2R,3S,4R)-3-[[3-(piperidine-1-carbonyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3S,4R)-3-[[3-(piperidine-1-carbonyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 100807206 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (1R,2R,3S,4R)-3-[[3-(piperidine-1-carbonyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | O=C(Nc1sccc1C(=O)N1CCCCC1)[C@@H]1[C@H](C(=O)O)[C@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C20H24N2O4S/c23-17(15-12-4-6-13(7-5-12)16(15)20(25)26)21-18-14(8-11-27-18)19(24)22-9-2-1-3-10-22/h4,6,8,11-13,15-16H,1-3,5,7,9-10H2,(H,21,23)(H,25,26)/t12-,13-,15-,16+/m0/s1 |
| InChIKey | IPNHNTCVZFLVFR-DARAHFNDSA-N |
| XLogP | 3.23 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|