C10H14O3 — CID 10081043
ethyl (1R,2S,4S)-3-methylidene-7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 10081043) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is ethyl (1R,2S,4S)-3-methylidene-7-oxabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (1R,2S,4S)-3-methylidene-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10081043 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | ethyl (1R,2S,4S)-3-methylidene-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C=C1[C@H](C(=O)OCC)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C10H14O3/c1-3-12-10(11)9-6(2)7-4-5-8(9)13-7/h7-9H,2-5H2,1H3/t7-,8+,9-/m0/s1 |
| InChIKey | ATBINYAHFBVFJI-YIZRAAEISA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|