C15H14F3N4O2+ — CID 100818949
2-[4-(hydrazinecarbonyl)pyridin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 100818949) has the molecular formula C15H14F3N4O2+ and a molecular weight of 339.30 g/mol. Its IUPAC name is 2-[4-(hydrazinecarbonyl)pyridin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(hydrazinecarbonyl)pyridin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 100818949 |
| Molecular Formula | C15H14F3N4O2+ |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[4-(hydrazinecarbonyl)pyridin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | NNC(=O)c1cc[n+](CC(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N4O2/c16-15(17,18)11-3-1-2-4-12(11)20-13(23)9-22-7-5-10(6-8-22)14(24)21-19/h1-8,19H,9H2,(H2,20,23,24)/p+1 |
| InChIKey | ZWHZMBNREGAMLX-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|