C15H20BrN3O3 — CID 100820914
4-(5-bromo-1-methylindazol-3-yl)oxy-N-(2-methoxyethyl)butanamide (PubChem CID 100820914) has the molecular formula C15H20BrN3O3 and a molecular weight of 370.25 g/mol. Its IUPAC name is 4-(5-bromo-1-methylindazol-3-yl)oxy-N-(2-methoxyethyl)butanamide.
| Compound Name | 4-(5-bromo-1-methylindazol-3-yl)oxy-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 100820914 |
| Molecular Formula | C15H20BrN3O3 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 4-(5-bromo-1-methylindazol-3-yl)oxy-N-(2-methoxyethyl)butanamide |
| SMILES | COCCNC(=O)CCCOc1nn(C)c2ccc(Br)cc12 |
| InChI | InChI=1S/C15H20BrN3O3/c1-19-13-6-5-11(16)10-12(13)15(18-19)22-8-3-4-14(20)17-7-9-21-2/h5-6,10H,3-4,7-9H2,1-2H3,(H,17,20) |
| InChIKey | IAAOOQRSTUOZKI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|