C16H19N5O2 — CID 100820937
4-(1-methylindazol-3-yl)oxy-N-(1-methylpyrazol-3-yl)butanamide (PubChem CID 100820937) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-(1-methylindazol-3-yl)oxy-N-(1-methylpyrazol-3-yl)butanamide.
| Compound Name | 4-(1-methylindazol-3-yl)oxy-N-(1-methylpyrazol-3-yl)butanamide |
|---|---|
| PubChem CID | 100820937 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-(1-methylindazol-3-yl)oxy-N-(1-methylpyrazol-3-yl)butanamide |
| SMILES | Cn1ccc(NC(=O)CCCOc2nn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C16H19N5O2/c1-20-10-9-14(18-20)17-15(22)8-5-11-23-16-12-6-3-4-7-13(12)21(2)19-16/h3-4,6-7,9-10H,5,8,11H2,1-2H3,(H,17,18,22) |
| InChIKey | OAOGLYYDQDALFS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|