C12H13NO4S — CID 100825839
(3aR,6aR)-3-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one (PubChem CID 100825839) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is (3aR,6aR)-3-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aR,6aR)-3-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 100825839 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (3aR,6aR)-3-(4-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one |
| SMILES | Cc1ccc(N2C(=O)O[C@H]3CS(=O)(=O)C[C@@H]32)cc1 |
| InChI | InChI=1S/C12H13NO4S/c1-8-2-4-9(5-3-8)13-10-6-18(15,16)7-11(10)17-12(13)14/h2-5,10-11H,6-7H2,1H3/t10-,11-/m0/s1 |
| InChIKey | UGLRMIXLBBAVAE-QWRGUYRKSA-N |
| XLogP | 1.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |