C6H9NO4S — CID 99976665
(3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one (PubChem CID 99976665) has the molecular formula C6H9NO4S and a molecular weight of 191.21 g/mol. Its IUPAC name is (3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 99976665 |
| Molecular Formula | C6H9NO4S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | (3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]oxazol-2-one |
| SMILES | CN1C(=O)O[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C6H9NO4S/c1-7-4-2-12(9,10)3-5(4)11-6(7)8/h4-5H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | UDBSALHWJYLINH-UHNVWZDZSA-N |
| XLogP | -0.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |