C16H18ClN3O2 — CID 100829183
2-(4-chloro-1-phenylpyrazol-3-yl)oxy-N-cyclopentylacetamide (PubChem CID 100829183) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 2-(4-chloro-1-phenylpyrazol-3-yl)oxy-N-cyclopentylacetamide.
| Compound Name | 2-(4-chloro-1-phenylpyrazol-3-yl)oxy-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 100829183 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-(4-chloro-1-phenylpyrazol-3-yl)oxy-N-cyclopentylacetamide |
| SMILES | O=C(COc1nn(-c2ccccc2)cc1Cl)NC1CCCC1 |
| InChI | InChI=1S/C16H18ClN3O2/c17-14-10-20(13-8-2-1-3-9-13)19-16(14)22-11-15(21)18-12-6-4-5-7-12/h1-3,8-10,12H,4-7,11H2,(H,18,21) |
| InChIKey | ZBBSZIOLVBNBOT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |