C7H11N3O5P+ — CID 10083393
2-[(2-amino-6-oxo-1H-pyrimidin-4-yl)oxy]ethoxymethyl-hydroxy-oxophosphanium (PubChem CID 10083393) has the molecular formula C7H11N3O5P+ and a molecular weight of 248.15 g/mol. Its IUPAC name is 2-[(2-amino-6-oxo-1H-pyrimidin-4-yl)oxy]ethoxymethyl-hydroxy-oxophosphanium.
| Compound Name | 2-[(2-amino-6-oxo-1H-pyrimidin-4-yl)oxy]ethoxymethyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 10083393 |
| Molecular Formula | C7H11N3O5P+ |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-[(2-amino-6-oxo-1H-pyrimidin-4-yl)oxy]ethoxymethyl-hydroxy-oxophosphanium |
| SMILES | Nc1nc(OCCOC[P+](=O)O)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H10N3O5P/c8-7-9-5(11)3-6(10-7)15-2-1-14-4-16(12)13/h3H,1-2,4H2,(H3-,8,9,10,11,12,13)/p+1 |
| InChIKey | GUIDVHGLSAYEHG-UHFFFAOYSA-O |
| XLogP | -0.56 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|