About 2-amino-4-propyl-1H-pyrimidin-6-one;azane
2-amino-4-propyl-1H-pyrimidin-6-one;azane (PubChem CID 167462255) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is 2-amino-4-propyl-1H-pyrimidin-6-one;azane.
Molecular Properties
| Compound Name | 2-amino-4-propyl-1H-pyrimidin-6-one;azane |
| PubChem CID | 167462255 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 2-amino-4-propyl-1H-pyrimidin-6-one;azane |
| SMILES | CCCc1cc(=O)[nH]c(N)n1.N |
| InChI | InChI=1S/C7H11N3O.H3N/c1-2-3-5-4-6(11)10-7(8)9-5;/h4H,2-3H2,1H3,(H3,8,9,10,11);1H3 |
| InChIKey | UCUCRJBEUBVHKD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-propyl-1H-pyrimidin-6-one;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-propyl-1H-pyrimidin-6-one;azane?
The IUPAC name of 2-amino-4-propyl-1H-pyrimidin-6-one;azane (CID 167462255) is 2-amino-4-propyl-1H-pyrimidin-6-one;azane.
What is the SMILES notation for 2-amino-4-propyl-1H-pyrimidin-6-one;azane?
The canonical SMILES for 2-amino-4-propyl-1H-pyrimidin-6-one;azane is CCCc1cc(=O)[nH]c(N)n1.N.
What is the InChIKey of 2-amino-4-propyl-1H-pyrimidin-6-one;azane?
The InChIKey is UCUCRJBEUBVHKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O.H3N/c1-2-3-5-4-6(11)10-7(8)9-5;/h4H,2-3H2,1H3,(H3,8,9,10,11);1H3.
What are the key properties of 2-amino-4-propyl-1H-pyrimidin-6-one;azane?
2-amino-4-propyl-1H-pyrimidin-6-one;azane has a molecular weight of 170.22 g/mol, XLogP of 0.47, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-propyl-1H-pyrimidin-6-one;azane is sourced from PubChem (CID 167462255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).