C7H9N2OSe — CID 135412657
6-Propyl-2-selenouracil (PubChem CID 135412657) has the molecular formula C7H9N2OSe and a molecular weight of 216.12 g/mol.
| Compound Name | 6-Propyl-2-selenouracil |
|---|---|
| PubChem CID | 135412657 |
| Molecular Formula | C7H9N2OSe |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | — |
| SMILES | CCCc1cc(=O)[nH]c([Se])n1 |
| InChI | InChI=1S/C7H9N2OSe/c1-2-3-5-4-6(10)9-7(11)8-5/h4H,2-3H2,1H3,(H,8,9,10) |
| InChIKey | ZXJNANZNCFMKTL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|