C13H14N2O3 — CID 136938589
2-(3,4-dihydroxyphenyl)-4-propyl-1H-pyrimidin-6-one (PubChem CID 136938589) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136938589 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(-c2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C13H14N2O3/c1-2-3-9-7-12(18)15-13(14-9)8-4-5-10(16)11(17)6-8/h4-7,16-17H,2-3H2,1H3,(H,14,15,18) |
| InChIKey | SABBPVUWMFWXFP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|