C13H13IN2O3 — CID 136889112
2-(3,4-dihydroxyphenyl)-5-iodo-4-propyl-1H-pyrimidin-6-one (PubChem CID 136889112) has the molecular formula C13H13IN2O3 and a molecular weight of 372.16 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-iodo-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-iodo-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136889112 |
| Molecular Formula | C13H13IN2O3 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-iodo-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1nc(-c2ccc(O)c(O)c2)[nH]c(=O)c1I |
| InChI | InChI=1S/C13H13IN2O3/c1-2-3-8-11(14)13(19)16-12(15-8)7-4-5-9(17)10(18)6-7/h4-6,17-18H,2-3H2,1H3,(H,15,16,19) |
| InChIKey | WWLLCMNUDUZCHM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|