C11H12IN3OS — CID 137005930
5-iodo-2-(2-methyl-1,3-thiazol-4-yl)-4-propyl-1H-pyrimidin-6-one (PubChem CID 137005930) has the molecular formula C11H12IN3OS and a molecular weight of 361.21 g/mol. Its IUPAC name is 5-iodo-2-(2-methyl-1,3-thiazol-4-yl)-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-2-(2-methyl-1,3-thiazol-4-yl)-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137005930 |
| Molecular Formula | C11H12IN3OS |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 5-iodo-2-(2-methyl-1,3-thiazol-4-yl)-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1nc(-c2csc(C)n2)[nH]c(=O)c1I |
| InChI | InChI=1S/C11H12IN3OS/c1-3-4-7-9(12)11(16)15-10(14-7)8-5-17-6(2)13-8/h5H,3-4H2,1-2H3,(H,14,15,16) |
| InChIKey | DWLCDCMWAJPWPT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|