C9H15N3O — CID 135973670
2-(dimethylamino)-4-propyl-1H-pyrimidin-6-one (PubChem CID 135973670) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-(dimethylamino)-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-(dimethylamino)-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135973670 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-(dimethylamino)-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(N(C)C)n1 |
| InChI | InChI=1S/C9H15N3O/c1-4-5-7-6-8(13)11-9(10-7)12(2)3/h6H,4-5H2,1-3H3,(H,10,11,13) |
| InChIKey | QFYKPIHHPFFQIQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |