C14H12O5 — CID 10083935
methyl (E)-4-(2-hydroxy-1,3-dioxoinden-2-yl)but-2-enoate (PubChem CID 10083935) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is methyl (E)-4-(2-hydroxy-1,3-dioxoinden-2-yl)but-2-enoate.
| Compound Name | methyl (E)-4-(2-hydroxy-1,3-dioxoinden-2-yl)but-2-enoate |
|---|---|
| PubChem CID | 10083935 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | methyl (E)-4-(2-hydroxy-1,3-dioxoinden-2-yl)but-2-enoate |
| SMILES | COC(=O)/C=C/CC1(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H12O5/c1-19-11(15)7-4-8-14(18)12(16)9-5-2-3-6-10(9)13(14)17/h2-7,18H,8H2,1H3/b7-4+ |
| InChIKey | PLESQBVHHMRWGK-QPJJXVBHSA-N |
| XLogP | 0.92 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|