C19H17NO4 — CID 100839756
(2R)-2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropanecarbonyl]-3-(2-methylfuran-3-yl)-3-oxopropanenitrile (PubChem CID 100839756) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R)-2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropanecarbonyl]-3-(2-methylfuran-3-yl)-3-oxopropanenitrile.
| Compound Name | (2R)-2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropanecarbonyl]-3-(2-methylfuran-3-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 100839756 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2R)-2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropanecarbonyl]-3-(2-methylfuran-3-yl)-3-oxopropanenitrile |
| SMILES | COc1ccc([C@@H]2C[C@@H]2C(=O)[C@@H](C#N)C(=O)c2ccoc2C)cc1 |
| InChI | InChI=1S/C19H17NO4/c1-11-14(7-8-24-11)18(21)17(10-20)19(22)16-9-15(16)12-3-5-13(23-2)6-4-12/h3-8,15-17H,9H2,1-2H3/t15-,16-,17-/m0/s1 |
| InChIKey | VTFQNYBOXXEANJ-ULQDDVLXSA-N |
| XLogP | 3.29 |
| TPSA | 80.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|