C14H12Cl2N2O2 — CID 95352742
(2S)-2-cyano-3-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-N-methyl-3-oxopropanamide (PubChem CID 95352742) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is (2S)-2-cyano-3-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-N-methyl-3-oxopropanamide.
| Compound Name | (2S)-2-cyano-3-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-N-methyl-3-oxopropanamide |
|---|---|
| PubChem CID | 95352742 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | (2S)-2-cyano-3-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropyl]-N-methyl-3-oxopropanamide |
| SMILES | CNC(=O)[C@@H](C#N)C(=O)[C@@H]1C[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H12Cl2N2O2/c1-18-14(20)10(6-17)13(19)9-5-8(9)7-2-3-11(15)12(16)4-7/h2-4,8-10H,5H2,1H3,(H,18,20)/t8-,9-,10+/m1/s1 |
| InChIKey | MHAUSLZDJLRROD-BBBLOLIVSA-N |
| XLogP | 2.55 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|