C14H11Cl2N3O — CID 95247693
trans-(1R,2R)-N,N-bis(cyanomethyl)-2-(3,4-dichlorophenyl)cyclopropane-1-carboxamide (PubChem CID 95247693) has the molecular formula C14H11Cl2N3O and a molecular weight of 308.17 g/mol. Its IUPAC name is trans-(1R,2R)-N,N-bis(cyanomethyl)-2-(3,4-dichlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N,N-bis(cyanomethyl)-2-(3,4-dichlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95247693 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | trans-(1R,2R)-N,N-bis(cyanomethyl)-2-(3,4-dichlorophenyl)cyclopropane-1-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)[C@@H]1C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2N3O/c15-12-2-1-9(7-13(12)16)10-8-11(10)14(20)19(5-3-17)6-4-18/h1-2,7,10-11H,5-6,8H2/t10-,11+/m0/s1 |
| InChIKey | RXTYMVKHAVCFIX-WDEREUQCSA-N |
| XLogP | 2.97 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|