C14H21FN2O — CID 100846119
(1S)-2-[(2R)-2,4-dimethylpiperazin-1-yl]-1-(3-fluorophenyl)ethanol (PubChem CID 100846119) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is (1S)-2-[(2R)-2,4-dimethylpiperazin-1-yl]-1-(3-fluorophenyl)ethanol.
| Compound Name | (1S)-2-[(2R)-2,4-dimethylpiperazin-1-yl]-1-(3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 100846119 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (1S)-2-[(2R)-2,4-dimethylpiperazin-1-yl]-1-(3-fluorophenyl)ethanol |
| SMILES | C[C@@H]1CN(C)CCN1C[C@@H](O)c1cccc(F)c1 |
| InChI | InChI=1S/C14H21FN2O/c1-11-9-16(2)6-7-17(11)10-14(18)12-4-3-5-13(15)8-12/h3-5,8,11,14,18H,6-7,9-10H2,1-2H3/t11-,14-/m1/s1 |
| InChIKey | LBKFPEFWVKURFF-BXUZGUMPSA-N |
| XLogP | 1.50 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |