C16H26N2O3S — CID 95322467
(1R)-2-[(2R)-2-methyl-4-(2-methylsulfonylethyl)piperazin-1-yl]-1-phenylethanol (PubChem CID 95322467) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is (1R)-2-[(2R)-2-methyl-4-(2-methylsulfonylethyl)piperazin-1-yl]-1-phenylethanol.
| Compound Name | (1R)-2-[(2R)-2-methyl-4-(2-methylsulfonylethyl)piperazin-1-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 95322467 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (1R)-2-[(2R)-2-methyl-4-(2-methylsulfonylethyl)piperazin-1-yl]-1-phenylethanol |
| SMILES | C[C@@H]1CN(CCS(C)(=O)=O)CCN1C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-14-12-17(10-11-22(2,20)21)8-9-18(14)13-16(19)15-6-4-3-5-7-15/h3-7,14,16,19H,8-13H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | ZIIYTYRKNOQJQF-ZBFHGGJFSA-N |
| XLogP | 0.77 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |