C14H20Cl2N2O — CID 100857129
(1S)-1-(2,5-dichlorophenyl)-2-[(2S)-2,4-dimethylpiperazin-1-yl]ethanol (PubChem CID 100857129) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is (1S)-1-(2,5-dichlorophenyl)-2-[(2S)-2,4-dimethylpiperazin-1-yl]ethanol.
| Compound Name | (1S)-1-(2,5-dichlorophenyl)-2-[(2S)-2,4-dimethylpiperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 100857129 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (1S)-1-(2,5-dichlorophenyl)-2-[(2S)-2,4-dimethylpiperazin-1-yl]ethanol |
| SMILES | C[C@H]1CN(C)CCN1C[C@@H](O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O/c1-10-8-17(2)5-6-18(10)9-14(19)12-7-11(15)3-4-13(12)16/h3-4,7,10,14,19H,5-6,8-9H2,1-2H3/t10-,14+/m0/s1 |
| InChIKey | JVPCVSWQSZPWIR-IINYFYTJSA-N |
| XLogP | 2.66 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |