C13H17Cl2NO2 — CID 94379698
(3S)-1-[(2R)-2-(2,5-dichlorophenyl)-2-hydroxyethyl]piperidin-3-ol (PubChem CID 94379698) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is (3S)-1-[(2R)-2-(2,5-dichlorophenyl)-2-hydroxyethyl]piperidin-3-ol.
| Compound Name | (3S)-1-[(2R)-2-(2,5-dichlorophenyl)-2-hydroxyethyl]piperidin-3-ol |
|---|---|
| PubChem CID | 94379698 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (3S)-1-[(2R)-2-(2,5-dichlorophenyl)-2-hydroxyethyl]piperidin-3-ol |
| SMILES | O[C@H]1CCCN(C[C@H](O)c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C13H17Cl2NO2/c14-9-3-4-12(15)11(6-9)13(18)8-16-5-1-2-10(17)7-16/h3-4,6,10,13,17-18H,1-2,5,7-8H2/t10-,13-/m0/s1 |
| InChIKey | KDPGERNJUSMQKS-GWCFXTLKSA-N |
| XLogP | 2.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |