C14H28O3Si — CID 10084652
[(E,4S)-4-hydroxy-6-trimethylsilylhex-5-enyl] 2,2-dimethylpropanoate (PubChem CID 10084652) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is [(E,4S)-4-hydroxy-6-trimethylsilylhex-5-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,4S)-4-hydroxy-6-trimethylsilylhex-5-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10084652 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | [(E,4S)-4-hydroxy-6-trimethylsilylhex-5-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCC[C@H](O)/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-14(2,3)13(16)17-10-7-8-12(15)9-11-18(4,5)6/h9,11-12,15H,7-8,10H2,1-6H3/b11-9+/t12-/m0/s1 |
| InChIKey | AVYDOMSRXJMAAJ-ZKQHCESOSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|