C18H20N2OS — CID 100850122
cis-(1S,2R)-2-methyl-N-[(6S)-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 100850122) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is cis-(1S,2R)-2-methyl-N-[(6S)-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-methyl-N-[(6S)-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 100850122 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | cis-(1S,2R)-2-methyl-N-[(6S)-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@@H]1C(=O)Nc1nc2c(s1)C[C@@H](c1ccccc1)CC2 |
| InChI | InChI=1S/C18H20N2OS/c1-11-9-14(11)17(21)20-18-19-15-8-7-13(10-16(15)22-18)12-5-3-2-4-6-12/h2-6,11,13-14H,7-10H2,1H3,(H,19,20,21)/t11-,13+,14+/m1/s1 |
| InChIKey | QCCFWKHNQFQVBQ-XBFCOCLRSA-N |
| XLogP | 4.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |