C19H15Cl2N3OS — CID 60596740
3,6-dichloro-N-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyridine-2-carboxamide (PubChem CID 60596740) has the molecular formula C19H15Cl2N3OS and a molecular weight of 404.32 g/mol. Its IUPAC name is 3,6-dichloro-N-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60596740 |
| Molecular Formula | C19H15Cl2N3OS |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 3,6-dichloro-N-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CC(c1ccccc1)CC2)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H15Cl2N3OS/c20-13-7-9-16(21)23-17(13)18(25)24-19-22-14-8-6-12(10-15(14)26-19)11-4-2-1-3-5-11/h1-5,7,9,12H,6,8,10H2,(H,22,24,25) |
| InChIKey | ZIMHHGIQVFNJQF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|