C14H19N5O2 — CID 10085575
1,3-dipropyl-4a,10a-dihydropurino[7,8-a]pyrimidine-2,4-dione (PubChem CID 10085575) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1,3-dipropyl-4a,10a-dihydropurino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 1,3-dipropyl-4a,10a-dihydropurino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10085575 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1,3-dipropyl-4a,10a-dihydropurino[7,8-a]pyrimidine-2,4-dione |
| SMILES | CCCN1C(=O)C2C(N=C3N=CC=CN32)N(CCC)C1=O |
| InChI | InChI=1S/C14H19N5O2/c1-3-7-18-11-10(12(20)19(8-4-2)14(18)21)17-9-5-6-15-13(17)16-11/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | DZLLYDJDGAFLBS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |