C10H14N4O2 — CID 135044914
3,7-dimethyl-1-prop-2-enyl-4,5-dihydropurine-2,6-dione (PubChem CID 135044914) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 3,7-dimethyl-1-prop-2-enyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-prop-2-enyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 135044914 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3,7-dimethyl-1-prop-2-enyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCN1C(=O)C2C(N=CN2C)N(C)C1=O |
| InChI | InChI=1S/C10H14N4O2/c1-4-5-14-9(15)7-8(11-6-12(7)2)13(3)10(14)16/h4,6-8H,1,5H2,2-3H3 |
| InChIKey | WSTFHEDSTAXMSA-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|