C17H24N4O — CID 10086185
8-amino-4-pentyl-11-propyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraen-10-one (PubChem CID 10086185) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 8-amino-4-pentyl-11-propyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraen-10-one.
| Compound Name | 8-amino-4-pentyl-11-propyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraen-10-one |
|---|---|
| PubChem CID | 10086185 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 8-amino-4-pentyl-11-propyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraen-10-one |
| SMILES | CCCCCn1ncc2c(N)c3c(nc21)CC(CCC)C3=O |
| InChI | InChI=1S/C17H24N4O/c1-3-5-6-8-21-17-12(10-19-21)15(18)14-13(20-17)9-11(7-4-2)16(14)22/h10-11H,3-9H2,1-2H3,(H2,18,20) |
| InChIKey | RTUREOKDTCTFBC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|