C22H26N4O2 — CID 70481088
[(E)-3-phenylprop-2-enyl] 4-amino-6-methyl-1-pentylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 70481088) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 4-amino-6-methyl-1-pentylpyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 4-amino-6-methyl-1-pentylpyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 70481088 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 4-amino-6-methyl-1-pentylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCCCCn1ncc2c(N)c(C(=O)OC/C=C/c3ccccc3)c(C)nc21 |
| InChI | InChI=1S/C22H26N4O2/c1-3-4-8-13-26-21-18(15-24-26)20(23)19(16(2)25-21)22(27)28-14-9-12-17-10-6-5-7-11-17/h5-7,9-12,15H,3-4,8,13-14H2,1-2H3,(H2,23,25)/b12-9+ |
| InChIKey | FVIVXWHBXSOECO-FMIVXFBMSA-N |
| XLogP | 4.38 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|