C18H21N5O — CID 57454904
4-(4-amino-1-pentylpyrazolo[3,4-b]pyridin-5-yl)benzamide (PubChem CID 57454904) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-(4-amino-1-pentylpyrazolo[3,4-b]pyridin-5-yl)benzamide.
| Compound Name | 4-(4-amino-1-pentylpyrazolo[3,4-b]pyridin-5-yl)benzamide |
|---|---|
| PubChem CID | 57454904 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-(4-amino-1-pentylpyrazolo[3,4-b]pyridin-5-yl)benzamide |
| SMILES | CCCCCn1ncc2c(N)c(-c3ccc(C(N)=O)cc3)cnc21 |
| InChI | InChI=1S/C18H21N5O/c1-2-3-4-9-23-18-15(11-22-23)16(19)14(10-21-18)12-5-7-13(8-6-12)17(20)24/h5-8,10-11H,2-4,9H2,1H3,(H2,19,21)(H2,20,24) |
| InChIKey | OADSUKAEYCXXNO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|