C22H18O3 — CID 100863451
(15R,17R,19R)-17-acetyl-15-methylpentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 100863451) has the molecular formula C22H18O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is (15R,17R,19R)-17-acetyl-15-methylpentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,17R,19R)-17-acetyl-15-methylpentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 100863451 |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (15R,17R,19R)-17-acetyl-15-methylpentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CC(=O)[C@@H]1C(=O)[C@@H]2C3c4ccccc4C(c4ccccc43)[C@@]2(C)C1=O |
| InChI | InChI=1S/C22H18O3/c1-11(23)16-20(24)19-17-12-7-3-5-9-14(12)18(22(19,2)21(16)25)15-10-6-4-8-13(15)17/h3-10,16-19H,1-2H3/t16-,17?,18?,19+,22-/m1/s1 |
| InChIKey | JGNUBXWXYARBKJ-FEWIUEFBSA-N |
| XLogP | 3.26 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|