C27H29N5O5 — CID 100874930
(4'aR,5S)-8'-nitro-3'-[(E)-3-phenylprop-2-enyl]-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 100874930) has the molecular formula C27H29N5O5 and a molecular weight of 503.56 g/mol. Its IUPAC name is (4'aR,5S)-8'-nitro-3'-[(E)-3-phenylprop-2-enyl]-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR,5S)-8'-nitro-3'-[(E)-3-phenylprop-2-enyl]-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 100874930 |
| Molecular Formula | C27H29N5O5 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (4'aR,5S)-8'-nitro-3'-[(E)-3-phenylprop-2-enyl]-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CC(C)N1C(=O)NC(=O)[C@@]2(Cc3cc([N+](=O)[O-])ccc3N3CCN(C/C=C/c4ccccc4)C[C@H]32)C1=O |
| InChI | InChI=1S/C27H29N5O5/c1-18(2)31-25(34)27(24(33)28-26(31)35)16-20-15-21(32(36)37)10-11-22(20)30-14-13-29(17-23(27)30)12-6-9-19-7-4-3-5-8-19/h3-11,15,18,23H,12-14,16-17H2,1-2H3,(H,28,33,35)/b9-6+/t23-,27-/m0/s1 |
| InChIKey | GZHCOHGDFOZHSR-RBLYKOFKSA-N |
| XLogP | 2.83 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|