C26H27N5O7 — CID 100866169
(4'aR,5S)-3'-(1,3-benzodioxol-5-ylmethyl)-8'-nitro-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 100866169) has the molecular formula C26H27N5O7 and a molecular weight of 521.53 g/mol. Its IUPAC name is (4'aR,5S)-3'-(1,3-benzodioxol-5-ylmethyl)-8'-nitro-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR,5S)-3'-(1,3-benzodioxol-5-ylmethyl)-8'-nitro-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 100866169 |
| Molecular Formula | C26H27N5O7 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | (4'aR,5S)-3'-(1,3-benzodioxol-5-ylmethyl)-8'-nitro-1-propan-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CC(C)N1C(=O)NC(=O)[C@@]2(Cc3cc([N+](=O)[O-])ccc3N3CCN(Cc4ccc5c(c4)OCO5)C[C@H]32)C1=O |
| InChI | InChI=1S/C26H27N5O7/c1-15(2)30-24(33)26(23(32)27-25(30)34)11-17-10-18(31(35)36)4-5-19(17)29-8-7-28(13-22(26)29)12-16-3-6-20-21(9-16)38-14-37-20/h3-6,9-10,15,22H,7-8,11-14H2,1-2H3,(H,27,32,34)/t22-,26-/m0/s1 |
| InChIKey | BYDLIMPCSBQXDK-NVQXNPDNSA-N |
| XLogP | 2.04 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|