C26H28N4O6 — CID 4870242
3'-(1,3-benzodioxol-5-ylmethyl)-1-(2-methoxyethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4870242) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is 3'-(1,3-benzodioxol-5-ylmethyl)-1-(2-methoxyethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 3'-(1,3-benzodioxol-5-ylmethyl)-1-(2-methoxyethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4870242 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 3'-(1,3-benzodioxol-5-ylmethyl)-1-(2-methoxyethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | COCCN1C(=O)NC(=O)C2(Cc3ccccc3N3CCN(Cc4ccc5c(c4)OCO5)CC32)C1=O |
| InChI | InChI=1S/C26H28N4O6/c1-34-11-10-30-24(32)26(23(31)27-25(30)33)13-18-4-2-3-5-19(18)29-9-8-28(15-22(26)29)14-17-6-7-20-21(12-17)36-16-35-20/h2-7,12,22H,8-11,13-16H2,1H3,(H,27,31,33) |
| InChIKey | MHGSDVVQBUQNGG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|