C25H28N4O5 — CID 100867232
(4'aR,5S)-1-(2-methoxyethyl)-3'-(4-methoxyphenyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 100867232) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is (4'aR,5S)-1-(2-methoxyethyl)-3'-(4-methoxyphenyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR,5S)-1-(2-methoxyethyl)-3'-(4-methoxyphenyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 100867232 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (4'aR,5S)-1-(2-methoxyethyl)-3'-(4-methoxyphenyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | COCCN1C(=O)NC(=O)[C@@]2(Cc3ccccc3N3CCN(c4ccc(OC)cc4)C[C@H]32)C1=O |
| InChI | InChI=1S/C25H28N4O5/c1-33-14-13-29-23(31)25(22(30)26-24(29)32)15-17-5-3-4-6-20(17)28-12-11-27(16-21(25)28)18-7-9-19(34-2)10-8-18/h3-10,21H,11-16H2,1-2H3,(H,26,30,32)/t21-,25-/m0/s1 |
| InChIKey | UCFBAGNHTPSGON-OFVILXPXSA-N |
| XLogP | 1.66 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|