C28H26Cl2N4O2 — CID 93153159
(4aS,5S)-9-chloro-2'-(4-chlorophenyl)-3-(4-methoxyphenyl)-5'-methylspiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one (PubChem CID 93153159) has the molecular formula C28H26Cl2N4O2 and a molecular weight of 521.45 g/mol. Its IUPAC name is (4aS,5S)-9-chloro-2'-(4-chlorophenyl)-3-(4-methoxyphenyl)-5'-methylspiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one.
| Compound Name | (4aS,5S)-9-chloro-2'-(4-chlorophenyl)-3-(4-methoxyphenyl)-5'-methylspiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one |
|---|---|
| PubChem CID | 93153159 |
| Molecular Formula | C28H26Cl2N4O2 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | (4aS,5S)-9-chloro-2'-(4-chlorophenyl)-3-(4-methoxyphenyl)-5'-methylspiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one |
| SMILES | COc1ccc(N2CCN3c4cc(Cl)ccc4C[C@]4(C(=O)N(c5ccc(Cl)cc5)N=C4C)[C@H]3C2)cc1 |
| InChI | InChI=1S/C28H26Cl2N4O2/c1-18-28(27(35)34(31-18)23-7-5-20(29)6-8-23)16-19-3-4-21(30)15-25(19)33-14-13-32(17-26(28)33)22-9-11-24(36-2)12-10-22/h3-12,15,26H,13-14,16-17H2,1-2H3/t26-,28-/m1/s1 |
| InChIKey | VVPFBYDGSKZHTF-IXCJQBJRSA-N |
| XLogP | 5.66 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|