C29H29ClN4O2 — CID 93153153
(4aS,5S)-9-chloro-3-(4-methoxyphenyl)-5'-methyl-2'-(4-methylphenyl)spiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one (PubChem CID 93153153) has the molecular formula C29H29ClN4O2 and a molecular weight of 501.03 g/mol. Its IUPAC name is (4aS,5S)-9-chloro-3-(4-methoxyphenyl)-5'-methyl-2'-(4-methylphenyl)spiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one.
| Compound Name | (4aS,5S)-9-chloro-3-(4-methoxyphenyl)-5'-methyl-2'-(4-methylphenyl)spiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one |
|---|---|
| PubChem CID | 93153153 |
| Molecular Formula | C29H29ClN4O2 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (4aS,5S)-9-chloro-3-(4-methoxyphenyl)-5'-methyl-2'-(4-methylphenyl)spiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one |
| SMILES | COc1ccc(N2CCN3c4cc(Cl)ccc4C[C@]4(C(=O)N(c5ccc(C)cc5)N=C4C)[C@H]3C2)cc1 |
| InChI | InChI=1S/C29H29ClN4O2/c1-19-4-8-24(9-5-19)34-28(35)29(20(2)31-34)17-21-6-7-22(30)16-26(21)33-15-14-32(18-27(29)33)23-10-12-25(36-3)13-11-23/h4-13,16,27H,14-15,17-18H2,1-3H3/t27-,29-/m1/s1 |
| InChIKey | UWUPDEOBNQWGSH-XRKRLSELSA-N |
| XLogP | 5.32 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|