C28H23Cl2F3N4O — CID 124810713
(4aR,5S)-3-(3-chlorophenyl)-2'-(4-chlorophenyl)-5'-methyl-8-(trifluoromethyl)spiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one (PubChem CID 124810713) has the molecular formula C28H23Cl2F3N4O and a molecular weight of 559.42 g/mol. Its IUPAC name is (4aR,5S)-3-(3-chlorophenyl)-2'-(4-chlorophenyl)-5'-methyl-8-(trifluoromethyl)spiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one.
| Compound Name | (4aR,5S)-3-(3-chlorophenyl)-2'-(4-chlorophenyl)-5'-methyl-8-(trifluoromethyl)spiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one |
|---|---|
| PubChem CID | 124810713 |
| Molecular Formula | C28H23Cl2F3N4O |
| Molecular Weight | 559.42 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | (4aR,5S)-3-(3-chlorophenyl)-2'-(4-chlorophenyl)-5'-methyl-8-(trifluoromethyl)spiro[2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline-5,4'-pyrazole]-3'-one |
| SMILES | CC1=NN(c2ccc(Cl)cc2)C(=O)[C@]12Cc1cc(C(F)(F)F)ccc1N1CCN(c3cccc(Cl)c3)C[C@H]12 |
| InChI | InChI=1S/C28H23Cl2F3N4O/c1-17-27(26(38)37(34-17)22-8-6-20(29)7-9-22)15-18-13-19(28(31,32)33)5-10-24(18)36-12-11-35(16-25(27)36)23-4-2-3-21(30)14-23/h2-10,13-14,25H,11-12,15-16H2,1H3/t25-,27+/m0/s1 |
| InChIKey | UKIIYEYMIDXUHS-AHKZPQOWSA-N |
| XLogP | 6.67 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.42 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |