C23H21ClF3N3O — CID 124807766
(4aS,5S)-2'-(4-chlorophenyl)-5'-methyl-8-(trifluoromethyl)spiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,4'-pyrazole]-3'-one (PubChem CID 124807766) has the molecular formula C23H21ClF3N3O and a molecular weight of 447.89 g/mol. Its IUPAC name is (4aS,5S)-2'-(4-chlorophenyl)-5'-methyl-8-(trifluoromethyl)spiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,4'-pyrazole]-3'-one.
| Compound Name | (4aS,5S)-2'-(4-chlorophenyl)-5'-methyl-8-(trifluoromethyl)spiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,4'-pyrazole]-3'-one |
|---|---|
| PubChem CID | 124807766 |
| Molecular Formula | C23H21ClF3N3O |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (4aS,5S)-2'-(4-chlorophenyl)-5'-methyl-8-(trifluoromethyl)spiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,4'-pyrazole]-3'-one |
| SMILES | CC1=NN(c2ccc(Cl)cc2)C(=O)[C@]12Cc1cc(C(F)(F)F)ccc1N1CCCC[C@H]12 |
| InChI | InChI=1S/C23H21ClF3N3O/c1-14-22(21(31)30(28-14)18-8-6-17(24)7-9-18)13-15-12-16(23(25,26)27)5-10-19(15)29-11-3-2-4-20(22)29/h5-10,12,20H,2-4,11,13H2,1H3/t20-,22+/m0/s1 |
| InChIKey | JKFFPBPVDGNIPG-RBBKRZOGSA-N |
| XLogP | 5.68 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |