C23H22F3N3O — CID 17037088
5'-methyl-2'-phenyl-8-(trifluoromethyl)spiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,4'-pyrazole]-3'-one (PubChem CID 17037088) has the molecular formula C23H22F3N3O and a molecular weight of 413.44 g/mol. Its IUPAC name is 5'-methyl-2'-phenyl-8-(trifluoromethyl)spiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,4'-pyrazole]-3'-one.
| Compound Name | 5'-methyl-2'-phenyl-8-(trifluoromethyl)spiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,4'-pyrazole]-3'-one |
|---|---|
| PubChem CID | 17037088 |
| Molecular Formula | C23H22F3N3O |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 5'-methyl-2'-phenyl-8-(trifluoromethyl)spiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,4'-pyrazole]-3'-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C12Cc1cc(C(F)(F)F)ccc1N1CCCCC12 |
| InChI | InChI=1S/C23H22F3N3O/c1-15-22(21(30)29(27-15)18-7-3-2-4-8-18)14-16-13-17(23(24,25)26)10-11-19(16)28-12-6-5-9-20(22)28/h2-4,7-8,10-11,13,20H,5-6,9,12,14H2,1H3 |
| InChIKey | LVPNZRZEDKYINV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |