C28H23F3N4O3 — CID 98442341
(4'aS,5R)-1,3'-diphenyl-8'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 98442341) has the molecular formula C28H23F3N4O3 and a molecular weight of 520.51 g/mol. Its IUPAC name is (4'aS,5R)-1,3'-diphenyl-8'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aS,5R)-1,3'-diphenyl-8'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 98442341 |
| Molecular Formula | C28H23F3N4O3 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (4'aS,5R)-1,3'-diphenyl-8'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | O=C1NC(=O)[C@]2(Cc3cc(C(F)(F)F)ccc3N3CCN(c4ccccc4)C[C@@H]32)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C28H23F3N4O3/c29-28(30,31)19-11-12-22-18(15-19)16-27(23-17-33(13-14-34(22)23)20-7-3-1-4-8-20)24(36)32-26(38)35(25(27)37)21-9-5-2-6-10-21/h1-12,15,23H,13-14,16-17H2,(H,32,36,38)/t23-,27-/m1/s1 |
| InChIKey | XWSJDULEXRRADF-YIXXDRMTSA-N |
| XLogP | 4.23 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|