C29H25F3N4O4 — CID 98442371
(4'aR,5S)-3'-(2-methoxyphenyl)-1-phenyl-8'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 98442371) has the molecular formula C29H25F3N4O4 and a molecular weight of 550.54 g/mol. Its IUPAC name is (4'aR,5S)-3'-(2-methoxyphenyl)-1-phenyl-8'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR,5S)-3'-(2-methoxyphenyl)-1-phenyl-8'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 98442371 |
| Molecular Formula | C29H25F3N4O4 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | (4'aR,5S)-3'-(2-methoxyphenyl)-1-phenyl-8'-(trifluoromethyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | COc1ccccc1N1CCN2c3ccc(C(F)(F)F)cc3C[C@@]3(C(=O)NC(=O)N(c4ccccc4)C3=O)[C@@H]2C1 |
| InChI | InChI=1S/C29H25F3N4O4/c1-40-23-10-6-5-9-22(23)34-13-14-35-21-12-11-19(29(30,31)32)15-18(21)16-28(24(35)17-34)25(37)33-27(39)36(26(28)38)20-7-3-2-4-8-20/h2-12,15,24H,13-14,16-17H2,1H3,(H,33,37,39)/t24-,28-/m0/s1 |
| InChIKey | CYDBEFKLZRPVJK-CUBQBAPOSA-N |
| XLogP | 4.23 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|