C30H33N5O4 — CID 4899660
8'-(2,5-dimethylpyrrol-1-yl)-3'-(2-methoxyphenyl)-1,3-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4899660) has the molecular formula C30H33N5O4 and a molecular weight of 527.63 g/mol. Its IUPAC name is 8'-(2,5-dimethylpyrrol-1-yl)-3'-(2-methoxyphenyl)-1,3-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 8'-(2,5-dimethylpyrrol-1-yl)-3'-(2-methoxyphenyl)-1,3-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4899660 |
| Molecular Formula | C30H33N5O4 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 8'-(2,5-dimethylpyrrol-1-yl)-3'-(2-methoxyphenyl)-1,3-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | COc1ccccc1N1CCN2c3ccc(-n4c(C)ccc4C)cc3CC3(C(=O)N(C)C(=O)N(C)C3=O)C2C1 |
| InChI | InChI=1S/C30H33N5O4/c1-19-10-11-20(2)35(19)22-12-13-23-21(16-22)17-30(27(36)31(3)29(38)32(4)28(30)37)26-18-33(14-15-34(23)26)24-8-6-7-9-25(24)39-5/h6-13,16,26H,14-15,17-18H2,1-5H3 |
| InChIKey | PRCUAMPLUKGJMM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|