C34H30N4O4 — CID 124818016
(4'aS)-3'-(2-methoxyphenyl)-1,3-diphenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 124818016) has the molecular formula C34H30N4O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is (4'aS)-3'-(2-methoxyphenyl)-1,3-diphenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aS)-3'-(2-methoxyphenyl)-1,3-diphenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 124818016 |
| Molecular Formula | C34H30N4O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | (4'aS)-3'-(2-methoxyphenyl)-1,3-diphenylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | COc1ccccc1N1CCN2c3ccccc3CC3(C(=O)N(c4ccccc4)C(=O)N(c4ccccc4)C3=O)[C@H]2C1 |
| InChI | InChI=1S/C34H30N4O4/c1-42-29-19-11-10-18-28(29)35-20-21-36-27-17-9-8-12-24(27)22-34(30(36)23-35)31(39)37(25-13-4-2-5-14-25)33(41)38(32(34)40)26-15-6-3-7-16-26/h2-19,30H,20-23H2,1H3/t30-/m1/s1 |
| InChIKey | JHJBUKXWODLPLO-SSEXGKCCSA-N |
| XLogP | 5.13 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|